Difference between revisions of "Tiso gene 19424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKKKJIJFFOK-VFU...") |
(Created page with "Category:Gene == Gene Tiso_gene_19424 == * right end position: ** 2320 * transcription direction: ** NEGATIVE * left end position: ** 310 * centisome position: ** 13.28191...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19424 == |
− | * | + | * right end position: |
− | ** | + | ** 2320 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 310 |
− | * | + | * centisome position: |
− | ** | + | ** 13.2819195 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[BETA-LACTAMASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2320}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=310}} | |
− | + | {{#set: centisome position=13.2819195 }} | |
− | + | {{#set: reaction associated=BETA-LACTAMASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:33, 21 March 2018
Gene Tiso_gene_19424
- right end position:
- 2320
- transcription direction:
- NEGATIVE
- left end position:
- 310
- centisome position:
- 13.2819195
- Synonym(s):
Reactions associated
- Reaction: BETA-LACTAMASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation