Difference between revisions of "Tiso gene 4457"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4457 == * Synonym(s): == Reactions associated == * Reaction: RXN-8038 ** Source: orthology-athaliana * Reaction: RXN-8040 ** S...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
+
== Gene Tiso_gene_4457 ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
* inchi key:
+
** InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
+
* common name:
+
** OPC8-3-hydroxyacyl-CoA
+
* molecular weight:
+
** 1055.92   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10698]]
+
* Reaction: [[RXN-8038]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-athaliana]]
* [[RXN-10697]]
+
* Reaction: [[RXN-8040]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN1F-147]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN1F-148]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN1F-150]]
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN1F-151]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways associated ==
 +
* [[PWY-5947]]
 +
* [[PWY-5946]]
 +
* [[PWY-5943]]
 +
* [[PWY-7591]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-8038|RXN-8040|RXN1F-147|RXN1F-148|RXN1F-150|RXN1F-151}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237307 44237307]
+
{{#set: pathway associated=PWY-5947|PWY-5946|PWY-5943|PWY-7591}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J}}
+
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
+
{{#set: molecular weight=1055.92    }}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA}}
+
{{#set: consumed by=RXN-10698}}
+
{{#set: produced by=RXN-10697}}
+

Latest revision as of 19:33, 21 March 2018

Gene Tiso_gene_4457

  • Synonym(s):

Reactions associated

Pathways associated

External links