Difference between revisions of "PWY-6535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * common name: ** thioguani...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6535 PWY-6535] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6535 PWY-6535] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
− | ** | + | ** 4-aminobutanoate degradation I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** γ-amino-butyrate shunt |
− | ** | + | ** GABA degradation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
− | + | * [[GABATRANSAM-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_11231]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_777]] | ||
+ | *** [[Tiso_gene_91]] | ||
+ | *** [[Tiso_gene_6952]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6535 PWY-6535] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-33154}} |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=4-aminobutanoate degradation I}} | |
− | + | {{#set: common name=γ-amino-butyrate shunt|GABA degradation}} | |
− | + | {{#set: reaction found=2}} | |
− | {{#set: | + | {{#set: total reaction=2}} |
− | {{#set: common name= | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:19, 21 March 2018
Pathway PWY-6535
- taxonomic range:
- common name:
- 4-aminobutanoate degradation I
- Synonym(s):
- γ-amino-butyrate shunt
- GABA degradation
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- GABATRANSAM-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: