Difference between revisions of "CPD-15977"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7651 RXN-7651] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O |
− | * | + | * common name: |
− | ** | + | ** 1,2-dioleoylglycerol |
+ | * inchi key: | ||
+ | ** InChIKey=AFSHUZFNMVJNKX-LLWMBOQKSA-N | ||
+ | * molecular weight: | ||
+ | ** 620.995 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** dioleoyl-sn-glycerol | ||
+ | ** diolein | ||
+ | ** 1,2-dioleoyl-DL-glycerol | ||
+ | ** 9-octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)- | ||
+ | ** glycerol dioleate | ||
+ | ** 1,2-diolein | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15090]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMGL02010049 |
− | ** [http://www. | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543716 9543716] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4593734.html 4593734] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52333 52333] |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O}} |
− | {{#set: | + | {{#set: common name=1,2-dioleoylglycerol}} |
+ | {{#set: inchi key=InChIKey=AFSHUZFNMVJNKX-LLWMBOQKSA-N}} | ||
+ | {{#set: molecular weight=620.995 }} | ||
+ | {{#set: common name=dioleoyl-sn-glycerol|diolein|1,2-dioleoyl-DL-glycerol|9-octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)-|glycerol dioleate|1,2-diolein}} | ||
+ | {{#set: produced by=RXN-15090}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-15977
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O
- common name:
- 1,2-dioleoylglycerol
- inchi key:
- InChIKey=AFSHUZFNMVJNKX-LLWMBOQKSA-N
- molecular weight:
- 620.995
- Synonym(s):
- dioleoyl-sn-glycerol
- diolein
- 1,2-dioleoyl-DL-glycerol
- 9-octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)-
- glycerol dioleate
- 1,2-diolein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links