Difference between revisions of "TRNA-Arg-adenosine34"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * common name: ** d...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-adenosine34 tRNA-Arg-adenosine34] == * common name: ** an adenosine34 in [tRNAArg2] *...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Arg-adenosine34 tRNA-Arg-adenosine34] ==
−
* smiles:
+
−
** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
+
 
* common name:
 
* common name:
−
** dopamine 3-O-sulfate
+
** an adenosine34 in [tRNAArg2]
−
* inchi key:
+
−
** InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 233.239   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
+
** [tRNAArg2]-adenosine34
−
** 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-1081]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN6666-9]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=an adenosine34 in [tRNAArg2]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13690 C13690]
+
{{#set: common name=[tRNAArg2]-adenosine34}}
−
* HMDB : HMDB06275
+
{{#set: consumed by=RXN0-1081}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133524 133524]
+
−
* METABOLIGHTS : MTBLC37946
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201578 25201578]
+
−
{{#set: smiles=C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)}}
+
−
{{#set: common name=dopamine 3-O-sulfate}}
+
−
{{#set: inchi key=InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=233.239    }}
+
−
{{#set: common name=5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate|4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)}}
+
−
{{#set: produced by=RXN6666-9}}
+

Latest revision as of 19:20, 21 March 2018

Metabolite tRNA-Arg-adenosine34

  • common name:
    • an adenosine34 in [tRNAArg2]
  • Synonym(s):
    • [tRNAArg2]-adenosine34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an adenosine34 in [tRNAArg2" cannot be used as a page name in this wiki.
"tRNAArg2]-adenosine34" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-Arg-adenosine34&oldid=40930"