Difference between revisions of "14-alpha-methylsteroids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=14-alpha-methylsteroids 14-alpha-methylsteroids] == * common name: ** a 14α-methylsteroid...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=14-alpha-methylsteroids 14-alpha-methylsteroids] ==
* smiles:
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
+
* inchi key:
+
** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
+
 
* common name:
 
* common name:
** ent-kaurenal
+
** a 14α-methylsteroid
* molecular weight:
+
** 286.456   
+
 
* Synonym(s):
 
* Synonym(s):
** ent-kaur-16-en-19-al
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7580]]
+
* [[RXN-13961]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5242]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 14α-methylsteroid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466]
+
{{#set: consumed by=RXN-13961}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.391680.html 391680]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873]
+
* HMDB : HMDB36728
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}}
+
{{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}}
+
{{#set: common name=ent-kaurenal}}
+
{{#set: molecular weight=286.456    }}
+
{{#set: common name=ent-kaur-16-en-19-al}}
+
{{#set: consumed by=RXN-7580}}
+
{{#set: produced by=RXN-5242}}
+

Latest revision as of 19:34, 21 March 2018

Metabolite 14-alpha-methylsteroids

  • common name:
    • a 14α-methylsteroid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links