Difference between revisions of "CPD1F-140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-in-tRNA Guanine26-in-tRNA] == * common name: ** a guanine26 in tRNA * Synonym(s): ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine26-in-tRNA Guanine26-in-tRNA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
 +
* smiles:
 +
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
** a guanine26 in tRNA
+
** gibberellin A20
 +
* inchi key:
 +
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
 +
* molecular weight:
 +
** 331.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA20
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12377]]
+
* [[RXN-113]]
* [[RXN-12375]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1F-169]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a guanine26 in tRNA}}
+
* PUBCHEM:
{{#set: consumed by=RXN-12377|RXN-12375}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A20}}
 +
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
 +
{{#set: molecular weight=331.388    }}
 +
{{#set: common name=GA20}}
 +
{{#set: consumed by=RXN-113}}
 +
{{#set: produced by=RXN1F-169}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD1F-140

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A20
  • inchi key:
    • InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
  • molecular weight:
    • 331.388
  • Synonym(s):
    • GA20

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.