Difference between revisions of "CPD-11519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCDm ATCDm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:CDP phosphotransferase, mitocho...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCDm ATCDm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
 
* common name:
 
* common name:
** ATP:CDP phosphotransferase, mitochondria
+
** OPC8-3-hydroxyacyl-CoA
 +
* inchi key:
 +
** InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
 +
* molecular weight:
 +
** 1055.92   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10698]]
** 1.0 [[ATP]][m] '''+''' 1.0 [[CDP]][m] '''=>''' 1.0 [[ADP]][m] '''+''' 1.0 [[CTP]][m]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10697]]
** 1.0 ATP[m] '''+''' 1.0 CDP[m] '''=>''' 1.0 ADP[m] '''+''' 1.0 CTP[m]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_16529]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=ATP:CDP phosphotransferase, mitochondria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237307 44237307]
{{#set: gene associated=Tiso_gene_16529}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: in pathway=}}
+
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=1055.92    }}
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA}}
 +
{{#set: consumed by=RXN-10698}}
 +
{{#set: produced by=RXN-10697}}

Latest revision as of 19:34, 21 March 2018

Metabolite CPD-11519

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • OPC8-3-hydroxyacyl-CoA
  • inchi key:
    • InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
  • molecular weight:
    • 1055.92
  • Synonym(s):
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.