Difference between revisions of "3-HYDROXYPIMELYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4083 RXN0-4083] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * common name: | ||
+ | ** 3-hydroxypimeloyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I | ||
+ | * molecular weight: | ||
+ | ** 920.648 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxypimelyl-CoA | ||
+ | ** 5-hydroxy-7-oxoheptanoyl-CoA | ||
+ | ** 3-hydroxy-6-carboxyhexanoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-15013]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266574 45266574] |
− | {{#set: | + | * HMDB : HMDB12155 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57343 57343] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06714 C06714] | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=3-hydroxypimeloyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I}} | ||
+ | {{#set: molecular weight=920.648 }} | ||
+ | {{#set: common name=3-hydroxypimelyl-CoA|5-hydroxy-7-oxoheptanoyl-CoA|3-hydroxy-6-carboxyhexanoyl-CoA}} | ||
+ | {{#set: reversible reaction associated=RXN-15013}} |
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite 3-HYDROXYPIMELYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-hydroxypimeloyl-CoA
- inchi key:
- InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I
- molecular weight:
- 920.648
- Synonym(s):
- 3-hydroxypimelyl-CoA
- 5-hydroxy-7-oxoheptanoyl-CoA
- 3-hydroxy-6-carboxyhexanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.