Difference between revisions of "L-GLUTAMATE-5-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15098 == * right end position: ** 1490 * transcription direction: ** NEGATIVE * left end position: ** 31 * centisome position: ** 0.5921681...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * co...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O |
− | * | + | * common name: |
− | ** | + | ** γ-L-glutamyl 5-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 225.094 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-glutamate 5-phosphate | ||
+ | ** γ-L-glutamyl-5-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[G5DH]] |
− | * | + | * [[GLUTSEMIALDEHYDROG-RXN]] |
− | + | * [[G5DHm]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[GLUTKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : glu5p |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44457531 44457531] |
− | {{#set: | + | * HMDB : HMDB01228 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03287 C03287] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58274 58274] | ||
+ | * METABOLIGHTS : MTBLC58274 | ||
+ | {{#set: smiles=C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O}} | ||
+ | {{#set: common name=γ-L-glutamyl 5-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L}} | ||
+ | {{#set: molecular weight=225.094 }} | ||
+ | {{#set: common name=L-glutamate 5-phosphate|γ-L-glutamyl-5-P}} | ||
+ | {{#set: consumed by=G5DH|GLUTSEMIALDEHYDROG-RXN|G5DHm}} | ||
+ | {{#set: produced by=GLUTKIN-RXN}} |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite L-GLUTAMATE-5-P
- smiles:
- C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O
- common name:
- γ-L-glutamyl 5-phosphate
- inchi key:
- InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L
- molecular weight:
- 225.094
- Synonym(s):
- L-glutamate 5-phosphate
- γ-L-glutamyl-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : glu5p
- PUBCHEM:
- HMDB : HMDB01228
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58274
"C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.