Difference between revisions of "Tiso gene 17632"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] == * smiles: ** CC(=O)NC1(C(O)OC(COP([O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_17632 == * Synonym(s): == Reactions associated == * Reaction: RXN0-1441 ** Source: orthology-esiliculosus == Pathways associated =...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] ==
+
== Gene Tiso_gene_17632 ==
* smiles:
+
** CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)
+
* common name:
+
** N-acetyl-D-mannosamine 6-phosphate
+
* inchi key:
+
** InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L
+
* molecular weight:
+
** 299.174   
+
 
* Synonym(s):
 
* Synonym(s):
** ManNAc-6-P
 
** N-acetylmannosamine-6-P
 
** N-acetyl-mannosamine-6-P
 
** N-acetyl-D-mannosamine-6-P
 
** N-acetyl-mannosamine 6-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-9988]]
+
* Reaction: [[RXN0-1441]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: reaction associated=RXN0-1441}}
** [http://www.genome.jp/dbget-bin/www_bget?C04257 C04257]
+
* HMDB : HMDB01121
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28273 28273]
+
* BIGG : acmanap
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758653 54758653]
+
{{#set: smiles=CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: common name=N-acetyl-D-mannosamine 6-phosphate}}
+
{{#set: inchi key=InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L}}
+
{{#set: molecular weight=299.174    }}
+
{{#set: common name=ManNAc-6-P|N-acetylmannosamine-6-P|N-acetyl-mannosamine-6-P|N-acetyl-D-mannosamine-6-P|N-acetyl-mannosamine 6-phosphate}}
+
{{#set: consumed by=RXN-9988}}
+

Latest revision as of 19:24, 21 March 2018

Gene Tiso_gene_17632

  • Synonym(s):

Reactions associated

Pathways associated

External links