Difference between revisions of "ENT-KAUR-16-EN-19-AL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12646 CPD-12646] == * smiles: ** CCCCCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4)))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ent-kaurenal |
+ | * inchi key: | ||
+ | ** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 286.456 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ent-kaur-16-en-19-al |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7580]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-5242]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.391680.html 391680] | ||
+ | * HMDB : HMDB36728 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873] |
− | {{#set: | + | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}} |
− | {{#set: molecular weight= | + | {{#set: common name=ent-kaurenal}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}} |
− | {{#set: consumed by=RXN- | + | {{#set: molecular weight=286.456 }} |
− | {{#set: produced by=RXN- | + | {{#set: common name=ent-kaur-16-en-19-al}} |
+ | {{#set: consumed by=RXN-7580}} | ||
+ | {{#set: produced by=RXN-5242}} |
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite ENT-KAUR-16-EN-19-AL
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
- common name:
- ent-kaurenal
- inchi key:
- InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
- molecular weight:
- 286.456
- Synonym(s):
- ent-kaur-16-en-19-al
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.