Difference between revisions of "UDP-N-ACETYLMURAMATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == * smiles: ** CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == |
* smiles: | * smiles: | ||
− | ** C(OP(=O)([O-])OP(=O)([O-]) | + | ** CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3) |
* common name: | * common name: | ||
− | ** | + | ** UDP-N-acetyl-α-D-muramate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 676.397 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** uridine diphosphate N-acetylmuramic acid |
− | ** | + | ** UDP-N-acetylmuramic acid |
+ | ** UDP-N-acetyl-D-muramate | ||
+ | ** UDP-MurNAc | ||
+ | ** UDP-N-acetylmuramoyl | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01050 C01050] |
+ | * HMDB : HMDB11720 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70757 70757] |
− | * | + | * BIGG : uamr |
− | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-]) | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24772978 24772978] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)}} |
− | {{#set: molecular weight= | + | {{#set: common name=UDP-N-acetyl-α-D-muramate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K}} |
− | + | {{#set: molecular weight=676.397 }} | |
− | {{#set: produced by= | + | {{#set: common name=uridine diphosphate N-acetylmuramic acid|UDP-N-acetylmuramic acid|UDP-N-acetyl-D-muramate|UDP-MurNAc|UDP-N-acetylmuramoyl}} |
+ | {{#set: produced by=UDPNACETYLMURAMATEDEHYDROG-RXN}} |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite UDP-N-ACETYLMURAMATE
- smiles:
- CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)
- common name:
- UDP-N-acetyl-α-D-muramate
- inchi key:
- InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K
- molecular weight:
- 676.397
- Synonym(s):
- uridine diphosphate N-acetylmuramic acid
- UDP-N-acetylmuramic acid
- UDP-N-acetyl-D-muramate
- UDP-MurNAc
- UDP-N-acetylmuramoyl
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)" cannot be used as a page name in this wiki.