Difference between revisions of "CPD0-1028"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** very long chain fatty acid biosynthesis II
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 +
* inchi key:
 +
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
 +
* molecular weight:
 +
** 447.424   
 
* Synonym(s):
 
* Synonym(s):
−
** cerotate biosynthesis
+
** di-trans,poly-cis-geranylgeranyl diphosphate
−
** hexacosanoate biosynthesis
+
** ω,E,E,Z-geranylgeranyl diphosphate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''16''' reactions found over '''16''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-13294]]
+
== Reaction(s) of unknown directionality ==
−
** 0 associated gene:
+
* [[RXN-13323]]
−
** 2 reconstruction source(s) associated:
+
* [[RXN0-5180]]
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13295]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13296]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13297]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13298]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13299]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13300]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13301]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13302]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13303]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13304]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13305]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-13306]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13307]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13308]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-13309]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
−
{{#set: common name=very long chain fatty acid biosynthesis II}}
+
* CHEBI:
−
{{#set: common name=cerotate biosynthesis|hexacosanoate biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
−
{{#set: reaction found=16}}
+
* LIGAND-CPD:
−
{{#set: total reaction=16}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
−
{{#set: completion rate=100.0}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
 +
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
 +
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
 +
{{#set: molecular weight=447.424    }}
 +
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
 +
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}

Latest revision as of 20:27, 21 March 2018

Metabolite CPD0-1028

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
  • common name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • inchi key:
    • InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
  • molecular weight:
    • 447.424
  • Synonym(s):
    • di-trans,poly-cis-geranylgeranyl diphosphate
    • ω,E,E,Z-geranylgeranyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-1028&oldid=41684"