Difference between revisions of "CREATINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycosides Glycosides] == * common name: ** a glycoside * Synonym(s): == Reaction(s) known to...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * common name: ** creatine * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == |
+ | * smiles: | ||
+ | ** C(C(=O)[O-])N(C)C(N)=[N+] | ||
* common name: | * common name: | ||
− | ** | + | ** creatine |
+ | * inchi key: | ||
+ | ** InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 131.134 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** methylguanidinoacetic acid | ||
+ | ** N-amidinosarcosine | ||
+ | ** methylglycocyamine | ||
+ | ** N-methyl-N-guanylglycine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CREATINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 57-00-1 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058172 7058172] | ||
+ | * HMDB : HMDB00064 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00300 C00300] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5414502.html 5414502] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57947 57947] | ||
+ | * METABOLIGHTS : MTBLC57947 | ||
+ | {{#set: smiles=C(C(=O)[O-])N(C)C(N)=[N+]}} | ||
+ | {{#set: common name=creatine}} | ||
+ | {{#set: inchi key=InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=131.134 }} | ||
+ | {{#set: common name=methylguanidinoacetic acid|N-amidinosarcosine|methylglycocyamine|N-methyl-N-guanylglycine}} | ||
+ | {{#set: consumed by=CREATINASE-RXN}} |
Latest revision as of 20:27, 21 March 2018
Contents
Metabolite CREATINE
- smiles:
- C(C(=O)[O-])N(C)C(N)=[N+]
- common name:
- creatine
- inchi key:
- InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N
- molecular weight:
- 131.134
- Synonym(s):
- methylguanidinoacetic acid
- N-amidinosarcosine
- methylglycocyamine
- N-methyl-N-guanylglycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 57-00-1
- PUBCHEM:
- HMDB : HMDB00064
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57947
"C(C(=O)[O-])N(C)C(N)=[N+" cannot be used as a page name in this wiki.