Difference between revisions of "PWY-7799"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] == * smiles: ** C(C(C[N+])=O)CC([O-])=O * common name: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C[N+])=O)CC([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** 5-aminolevulinate
+
** Arg/N-end rule pathway (eukaryotic)
−
* inchi key:
+
−
** InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 131.131   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-4-oxopentanoate
 
−
** 5-amino-4-oxo-pentanoic acid
 
−
** 5-amino-levulinic acid
 
−
** 5-amino-4-oxopentanoic acid
 
−
** δ-aminolevulinate
 
−
** 5-aminolevulinic acid
 
−
** 5-amino-levulinate
 
−
** ALA
 
−
** δ-aminolevulinic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PORPHOBILSYNTH-RXN]]
+
'''8''' reactions found over '''14''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-17850]]
−
* [[GSAAMINOTRANS-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-17851]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-17874]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_4247]]
 +
*** [[Tiso_gene_5715]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-17881]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-17882]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-17883]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-17892]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3550]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-17893]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3550]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17849 RXN-17849]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17879 RXN-17879]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17889 RXN-17889]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17890 RXN-17890]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17891 RXN-17891]
 
== External links  ==
 
== External links  ==
−
* CAS : 106-60-5
+
{{#set: taxonomic range=TAX-33208}}
−
* BIGG : 5aop
+
{{#set: taxonomic range=TAX-33090}}
−
* PUBCHEM:
+
{{#set: common name=Arg/N-end rule pathway (eukaryotic)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048523 7048523]
+
{{#set: reaction found=8}}
−
* HMDB : HMDB01149
+
{{#set: total reaction=14}}
−
* LIGAND-CPD:
+
{{#set: completion rate=57.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00430 C00430]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=356416 356416]
+
−
* METABOLIGHTS : MTBLC356416
+
−
{{#set: smiles=C(C(C[N+])=O)CC([O-])=O}}
+
−
{{#set: common name=5-aminolevulinate}}
+
−
{{#set: inchi key=InChIKey=ZGXJTSGNIOSYLO-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=131.131    }}
+
−
{{#set: common name=5-amino-4-oxopentanoate|5-amino-4-oxo-pentanoic acid|5-amino-levulinic acid|5-amino-4-oxopentanoic acid|δ-aminolevulinate|5-aminolevulinic acid|5-amino-levulinate|ALA|δ-aminolevulinic acid}}
+
−
{{#set: consumed by=PORPHOBILSYNTH-RXN}}
+
−
{{#set: produced by=GSAAMINOTRANS-RXN}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-7799

  • taxonomic range:
  • common name:
    • Arg/N-end rule pathway (eukaryotic)
  • Synonym(s):

Reaction(s) found

8 reactions found over 14 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7799&oldid=41791"