Difference between revisions of "Short-Mannan"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Mannan Short-Mannan] == * common name: ** a β-(1,4)-mannan oligosaccharide * Synonym...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Mannan Short-Mannan] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a β-(1,4)-mannan oligosaccharide |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a (1→4)-β-D-mannooligosaccharide |
− | ** | + | ** a short β-(1,4)-mannoglycan |
− | ** | + | ** a short β-(1,4)-mannan |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.2.1.78-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a β-(1,4)-mannan oligosaccharide}} | |
− | + | {{#set: common name=a (1→4)-β-D-mannooligosaccharide|a short β-(1,4)-mannoglycan|a short β-(1,4)-mannan}} | |
− | + | {{#set: produced by=3.2.1.78-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:34, 21 March 2018
Contents
Metabolite Short-Mannan
- common name:
- a β-(1,4)-mannan oligosaccharide
- Synonym(s):
- a (1→4)-β-D-mannooligosaccharide
- a short β-(1,4)-mannoglycan
- a short β-(1,4)-mannan