Difference between revisions of "Short-Mannan"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Mannan Short-Mannan] == * common name: ** a β-(1,4)-mannan oligosaccharide * Synonym...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Mannan Short-Mannan] ==
* smiles:
+
** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)
+
* inchi key:
+
** InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M
+
 
* common name:
 
* common name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+
** a β-(1,4)-mannan oligosaccharide
* molecular weight:
+
** 293.425   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
+
** a (1→4)-β-D-mannooligosaccharide
** oxopentenyl-cyclopentane-octanoic acid
+
** a short  β-(1,4)-mannoglycan
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
+
** a short  β-(1,4)-mannan
** OPC8
+
** OPC-8:0
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10695]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.78-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMFA02010006
+
{{#set: common name=a β-(1,4)-mannan oligosaccharide}}
* PUBCHEM:
+
{{#set: common name=a (1→4)-β-D-mannooligosaccharide|a short  β-(1,4)-mannoglycan|a short  β-(1,4)-mannan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244083 25244083]
+
{{#set: produced by=3.2.1.78-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780]
+
* HMDB : HMDB36217
+
{{#set: smiles=CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M}}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+
{{#set: molecular weight=293.425    }}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}}
+
{{#set: consumed by=RXN-10695}}
+

Latest revision as of 19:34, 21 March 2018

Metabolite Short-Mannan

  • common name:
    • a β-(1,4)-mannan oligosaccharide
  • Synonym(s):
    • a (1→4)-β-D-mannooligosaccharide
    • a short β-(1,4)-mannoglycan
    • a short β-(1,4)-mannan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links