Difference between revisions of "CPD-6702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12459 RXN-12459] == * direction: ** LEFT-TO-RIGHT * common name: ** trna_(guanine-n1)-methyltra...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * common name: *...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12459 RXN-12459] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
 
* common name:
 
* common name:
−
** trna_(guanine-n1)-methyltransferase_family_protein
+
** 1D-myo-inositol 6-monophosphate
−
** trna_(guanine-n1-)-methyltransferase_domain_containing_protein
+
* inchi key:
−
** mitochondrial_ribonuclease_p_protein_1_homolog
+
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.1.1.221 EC-2.1.1.221]
+
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** Ins(6)P1
 +
** 1D-myo-inositol 6-phosphate
 +
** Ins(6)P
 +
** Ins6P
 +
** D-myo-inositol 6-monophosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10954]]
−
** 1 [[Guanine9-in-tRNA]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[tRNA-Containing-N1-Methylguanine-9]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a guanine9 in tRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 an N1-methylguanine9 in tRNA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_5025]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_910]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_909]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_299]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trna_(guanine-n1)-methyltransferase_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
−
{{#set: common name=trna_(guanine-n1-)-methyltransferase_domain_containing_protein}}
+
* CHEBI:
−
{{#set: common name=mitochondrial_ribonuclease_p_protein_1_homolog}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
−
{{#set: ec number=EC-2.1.1.221}}
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
−
{{#set: gene associated=Tiso_gene_5025|Tiso_gene_910|Tiso_gene_909|Tiso_gene_299}}
+
{{#set: common name=1D-myo-inositol 6-monophosphate}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-10954}}

Latest revision as of 19:28, 21 March 2018

Metabolite CPD-6702

  • smiles:
    • C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
  • common name:
    • 1D-myo-inositol 6-monophosphate
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
  • molecular weight:
    • 258.121
  • Synonym(s):
    • Ins(6)P1
    • 1D-myo-inositol 6-phosphate
    • Ins(6)P
    • Ins6P
    • D-myo-inositol 6-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6702&oldid=41858"