Difference between revisions of "RXN0-5289"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5289 RXN0-5289] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5289 RXN0-5289] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
−
* common name:
+
* ec number:
−
** chlorophyllide a
+
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
−
* molecular weight:
+
−
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7663]]
+
* With identifiers:
−
* [[RXN-7676]]
+
** 1 [[GLYCERATE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[TARTRONATE-S-ALD]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN-13398]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 D-glycerate[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 tartronate semialdehyde[c] '''+''' 1 H+[c]
−
* [[RXN-5286]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN1F-10]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN1F-66]]
+
* Gene: [[Tiso_gene_777]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_91]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[GLYCOLATEMET-PWY]], glycolate and glyoxylate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEMET-PWY GLYCOLATEMET-PWY]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01745 R01745]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
{{#set: direction=REVERSIBLE}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
{{#set: gene associated=Tiso_gene_777|Tiso_gene_91}}
−
* LIGAND-CPD:
+
{{#set: in pathway=GLYCOLATEMET-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=chlorophyllide a}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=612.967    }}
+
−
{{#set: common name=chlorophyllide}}
+
−
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
+
−
{{#set: produced by=RXN-5286}}
+
−
{{#set: reversible reaction associated=RXN1F-10|RXN1F-66}}
+

Latest revision as of 19:29, 21 March 2018

Reaction RXN0-5289

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 D-glycerate[c] + 1 NAD+[c] <=> 1 NADH[c] + 1 tartronate semialdehyde[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-5289&oldid=41945"