Difference between revisions of "RXN0-7192"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * c...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.4.15 EC-6.3.4.15] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[PROTON]][c] '''+''' 1 [[BIOTIN]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[BIO-5-AMP]][c] '''+''' 1 [[PPI]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 H+[c] '''+''' 1 biotin[c] '''+''' 1 ATP[c] '''=>''' 1 biotinyl-5'-adenylate[c] '''+''' 1 diphosphate[c] | |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | * [[ | + | * Gene: [[Tiso_gene_14184]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Assignment: EC-NUMBER |
− | * [[ | + | == Pathways == |
− | * [[ | + | == Reconstruction information == |
− | * [[ | + | * Category: [[annotation]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: ec number=EC-6.3.4.15}} | |
− | + | {{#set: gene associated=Tiso_gene_14184}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Contents
Reaction RXN0-7192
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H+[c] + 1 biotin[c] + 1 ATP[c] => 1 biotinyl-5'-adenylate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14184
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation