Difference between revisions of "CPD0-1718"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6876 PWY-6876] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * common name: ** 7,8-dihyd...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) |
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydropterin |
| + | * inchi key: | ||
| + | ** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 165.154 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** dihydropterin | ||
| + | ** H2-pterin | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-15261]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.58752.html 58752] |
| + | {{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}} | ||
| + | {{#set: common name=7,8-dihydropterin}} | ||
| + | {{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=165.154 }} | ||
| + | {{#set: common name=dihydropterin|H2-pterin}} | ||
| + | {{#set: consumed by=RXN-15261}} | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite CPD0-1718
- smiles:
- C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
- common name:
- 7,8-dihydropterin
- inchi key:
- InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
- molecular weight:
- 165.154
- Synonym(s):
- dihydropterin
- H2-pterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
