Difference between revisions of "Tiso gene 3056"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...")
(Created page with "Category:Gene == Gene Tiso_gene_3056 == * right end position: ** 11216 * transcription direction: ** POSITIVE * left end position: ** 9014 * centisome position: ** 51.1432...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+
== Gene Tiso_gene_3056 ==
−
* smiles:
+
* right end position:
−
** C(C(NC(C(O)=O)[R])=O)N
+
** 11216
−
* common name:
+
* transcription direction:
−
** glycyl-peptide
+
** POSITIVE
 +
* left end position:
 +
** 9014
 +
* centisome position:
 +
** 51.143265   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CARBODEHYDRAT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2.3.1.97-RXN]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-5224]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-241]]
 +
* [[PWYQT-4429]]
 +
* [[PWY-7117]]
 +
* [[PWY-7115]]
 +
* [[PWY-6142]]
 +
* [[CYANCAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=11216}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=9014}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462]
+
{{#set: centisome position=51.143265    }}
−
{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}}
+
{{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}}
−
{{#set: common name=glycyl-peptide}}
+
{{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}}
−
{{#set: reversible reaction associated=2.3.1.97-RXN}}
+

Latest revision as of 19:31, 21 March 2018

Gene Tiso_gene_3056

  • right end position:
    • 11216
  • transcription direction:
    • POSITIVE
  • left end position:
    • 9014
  • centisome position:
    • 51.143265
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3056&oldid=42172"