Difference between revisions of "PWY-6074"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLITOL XYLITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * common name: ** xylitol * inchi key: ** I...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLITOL XYLITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] ==
* smiles:
+
* taxonomic range:
** C(O)C(O)C(O)C(O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 
* common name:
 
* common name:
** xylitol
+
** zymosterol biosynthesis
* inchi key:
+
** InChIKey=HEBKCHPVOIAQTA-SCDXWVJYSA-N
+
* molecular weight:
+
** 152.147   
+
 
* Synonym(s):
 
* Synonym(s):
** (2R,3R,4S)-pentane-1,2,3,4,5-pentaol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[1.1.3.41-RXN]]
+
'''4''' reactions found over '''12''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN3O-130]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[RXN-8773]]
+
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-306]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10982]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-313]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-318]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_897]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319]
 
== External links  ==
 
== External links  ==
* CAS : 87-99-0
+
{{#set: taxonomic range=TAX-33154}}
* Wikipedia : Xylitol
+
{{#set: common name=zymosterol biosynthesis}}
* DRUGBANK : DB01904
+
{{#set: reaction found=4}}
* PUBCHEM:
+
{{#set: total reaction=12}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6912 6912]
+
{{#set: completion rate=33.0}}
* HMDB : HMDB02917
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00379 C00379]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.6646.html 6646]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17151 17151]
+
* METABOLIGHTS : MTBLC17151
+
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
{{#set: common name=xylitol}}
+
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-SCDXWVJYSA-N}}
+
{{#set: molecular weight=152.147    }}
+
{{#set: common name=(2R,3R,4S)-pentane-1,2,3,4,5-pentaol}}
+
{{#set: consumed by=1.1.3.41-RXN}}
+
{{#set: reversible reaction associated=RXN-8773}}
+

Latest revision as of 19:31, 21 March 2018

Pathway PWY-6074

  • taxonomic range:
  • common name:
    • zymosterol biosynthesis
  • Synonym(s):

Reaction(s) found

4 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links