Difference between revisions of "CPD-730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] == * direction: ** LEFT-TO-RIGHT * common name: ** aminopeptidase_n ** membrane_...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * common name: ** 3-oxo-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)
 
* common name:
 
* common name:
−
** aminopeptidase_n
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
−
** membrane_aminopeptidase_i
+
* inchi key:
−
* ec number:
+
** InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M
−
** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2]
+
* molecular weight:
 +
** 293.425   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
 +
** oxopentenyl-cyclopentane-octanoic acid
 +
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
 +
** OPC8
 +
** OPC-8:0
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10695]]
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-6262]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[S-Substituted-L-Cysteines]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 a [Cys-Gly]-S-conjugate[c] '''=>''' 1 glycine[c] '''+''' 1 an L-cysteine-S-conjugate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_860]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_16906]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842]
+
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMFA02010006
−
{{#set: common name=aminopeptidase_n}}
+
* PUBCHEM:
−
{{#set: common name=membrane_aminopeptidase_i}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244083 25244083]
−
{{#set: ec number=EC-3.4.11.2}}
+
* HMDB : HMDB36217
−
{{#set: gene associated=Tiso_gene_860|Tiso_gene_16906}}
+
* CHEBI:
−
{{#set: in pathway=PWY-6842|PWY-4061}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780]
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: smiles=CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=293.425    }}
 +
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}}
 +
{{#set: consumed by=RXN-10695}}

Latest revision as of 20:35, 21 March 2018

Metabolite CPD-730

  • smiles:
    • CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)
  • common name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
  • inchi key:
    • InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M
  • molecular weight:
    • 293.425
  • Synonym(s):
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
    • oxopentenyl-cyclopentane-octanoic acid
    • 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
    • OPC8
    • OPC-8:0

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMFA02010006
  • PUBCHEM:
  • HMDB : HMDB36217
  • CHEBI:
  • LIGAND-CPD:
"CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)" cannot be used as a page name in this wiki.


"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-730&oldid=42531"