Difference between revisions of "Tiso gene 2246"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_2246 == * right end position: ** 19716 * transcription direction: ** POSITIVE * left end position: ** 15552 * centisome position: ** 77.659...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] ==
+
== Gene Tiso_gene_2246 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)CCCC([N+])C(=O)[O-]
+
** 19716
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-2-amino-6-oxohexanoate
+
** 15552
−
* molecular weight:
+
* centisome position:
−
** 145.158    
+
** 77.65904    
 
* Synonym(s):
 
* Synonym(s):
−
** allysine
 
−
** L-2-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate 6-semialdehyde
 
−
** α-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate semialdehyde
 
−
** L-allysine
 
−
** (S)-2-aminoadipate 6-semialdehyde
 
−
** 2-aminoadipate-6-semialdehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.2.1.31-RXN]]
+
* Reaction: [[RXN0-1461]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[1.5.1.9-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[ALLYSINE-DEHYDROG-RXN]]
+
*** Assignment: ec-number
−
* [[RXN-8173]]
+
== Pathways associated ==
 +
* [[PWY0-1415]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[PWY-7159]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1962-83-0
+
{{#set: right end position=19716}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688062 36688062]
+
{{#set: left end position=15552}}
−
* HMDB : HMDB59595
+
{{#set: centisome position=77.65904   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN0-1461}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04076 C04076]
+
{{#set: pathway associated=PWY0-1415|HEME-BIOSYNTHESIS-II|CHLOROPHYLL-SYN|PWY-7159}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58321 58321]
+
−
* METABOLIGHTS : MTBLC58321
+
−
{{#set: smiles=[CH](=O)CCCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N}}
+
−
{{#set: common name=(S)-2-amino-6-oxohexanoate}}
+
−
{{#set: molecular weight=145.158   }}
+
−
{{#set: common name=allysine|L-2-aminoadipate 6-semialdehyde|2-aminoadipate 6-semialdehyde|α-aminoadipate 6-semialdehyde|2-aminoadipate semialdehyde|L-allysine|(S)-2-aminoadipate 6-semialdehyde|2-aminoadipate-6-semialdehyde}}
+
−
{{#set: consumed by=1.2.1.31-RXN}}
+
−
{{#set: produced by=1.5.1.9-RXN}}
+
−
{{#set: consumed or produced by=ALLYSINE-DEHYDROG-RXN|RXN-8173}}
+

Latest revision as of 19:35, 21 March 2018

Gene Tiso_gene_2246

  • right end position:
    • 19716
  • transcription direction:
    • POSITIVE
  • left end position:
    • 15552
  • centisome position:
    • 77.65904
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2246&oldid=42532"