Difference between revisions of "RXN-9535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * common name:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** 3-oxoa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** polyketide_synthase |
− | * | + | ** 3-oxoacyl-synthase |
− | ** | + | * ec number: |
− | * | + | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-ketoacyl-ACP synthase I |
− | ** | + | ** β-ketoacyl-acyl carrier protein synthetase |
− | ** | + | ** β-ketoacyl-[acyl carrier protein] synthase |
− | ** | + | ** condensing enzyme |
− | ** | + | ** β-ketoacyl acyl carrier protein synthase |
− | ** | + | ** 3-oxoacyl-[acyl-carrier-protein] synthase |
+ | ** acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating) | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[MALONYL-ACP]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-myristoyl-ACPs]][c] '''+''' 1 [[ACP]][c] | |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 a malonyl-[acp][c] '''+''' 1 a dodecanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-myristoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_500]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_13394]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_15991]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Gene: [[Tiso_gene_14485]] |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Gene: [[Tiso_gene_135]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_19302]] |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Gene: [[Tiso_gene_10876]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
+ | * Gene: [[Tiso_gene_5939]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_136]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=polyketide_synthase}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.86}} | |
− | + | {{#set: ec number=EC-2.3.1.85}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: common name=β-ketoacyl-ACP synthase I|β-ketoacyl-acyl carrier protein synthetase|β-ketoacyl-[acyl carrier protein] synthase|condensing enzyme|β-ketoacyl acyl carrier protein synthase|3-oxoacyl-[acyl-carrier-protein] synthase|acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)}} | |
− | + | {{#set: gene associated=Tiso_gene_500|Tiso_gene_13394|Tiso_gene_15991|Tiso_gene_14485|Tiso_gene_135|Tiso_gene_19302|Tiso_gene_10876|Tiso_gene_5939|Tiso_gene_136}} | |
− | + | {{#set: in pathway=PWY-5971}} | |
− | + | {{#set: reconstruction category=orthology|manual|annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Contents
Reaction RXN-9535
- direction:
- LEFT-TO-RIGHT
- common name:
- polyketide_synthase
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
- β-ketoacyl-ACP synthase I
- β-ketoacyl-acyl carrier protein synthetase
- β-ketoacyl-[acyl carrier protein] synthase
- condensing enzyme
- β-ketoacyl acyl carrier protein synthase
- 3-oxoacyl-[acyl-carrier-protein] synthase
- acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)
Reaction Formula
- With identifiers:
- 1 MALONYL-ACP[c] + 1 Dodecanoyl-ACPs[c] + 1 PROTON[c] => 1 CARBON-DIOXIDE[c] + 1 3-oxo-myristoyl-ACPs[c] + 1 ACP[c]
- With common name(s):
- 1 a malonyl-[acp][c] + 1 a dodecanoyl-[acp][c] + 1 H+[c] => 1 CO2[c] + 1 a 3-oxo-myristoyl-[acp][c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_500
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15991
- Source: orthology-athaliana
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14485
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Gene: Tiso_gene_135
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19302
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10876
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_136
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- "β-ketoacyl-[acyl carrier protein] synthase" cannot be used as a page name in this wiki.
- "3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.
- "acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" cannot be used as a page name in this wiki.