Difference between revisions of "RXN-9535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * common name:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** 3-oxoa...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** UMP
+
** polyketide_synthase
−
* inchi key:
+
** 3-oxoacyl-synthase
−
** InChIKey=DJJCXFVJDGTHFX-XVFCMESISA-L
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
−
** 322.168   
+
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** uridylate
+
** β-ketoacyl-ACP synthase I
−
** 5'-UMP
+
** β-ketoacyl-acyl carrier protein synthetase
−
** uridine 5'-phosphate
+
** β-ketoacyl-[acyl carrier protein] synthase
−
** 5'-uridylic acid (8CI)(9CI)
+
** condensing enzyme
−
** uridine monophosphate
+
** β-ketoacyl acyl carrier protein synthase
−
** uridine 5'-monophosphate
+
** 3-oxoacyl-[acyl-carrier-protein] synthase
 +
** acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[UMPKf]]
+
* With identifiers:
−
* [[RXN-14025]]
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-myristoyl-ACPs]][c] '''+''' 1 [[ACP]][c]
−
* [[UMPP]]
+
* With common name(s):
−
* [[RXN-12002]]
+
** 1 a malonyl-[acp][c] '''+''' 1 a dodecanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-myristoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c]
−
== Reaction(s) known to produce the compound ==
+
 
−
* [[orPDC]]
+
== Genes associated with this reaction  ==
−
* [[UTPPH]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[GTUP]]
+
* Gene: [[Tiso_gene_500]]
−
* [[AUPT]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[OROTPDECARB-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[UTUP]]
+
* Gene: [[Tiso_gene_13394]]
−
* [[DGTUP]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-11347]]
+
*** Assignment: EC-NUMBER
−
* [[DUTUP]]
+
* Gene: [[Tiso_gene_15991]]
−
* [[DCTUP]]
+
** Source: [[orthology-athaliana]]
−
* [[2.7.8.15-RXN]]
+
** Source: [[orthology-athaliana]]
−
* [[DATUP]]
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-14139]]
+
* Gene: [[Tiso_gene_14485]]
−
* [[RXN-12197]]
+
** Source: [[orthology-synechocystis]]
−
* [[UPH]]
+
** Source: [[orthology-esiliculosus]]
−
* [[DTTUP]]
+
* Gene: [[Tiso_gene_135]]
−
* [[RXN-12199]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[URIDINEKIN-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[ITUP]]
+
* Gene: [[Tiso_gene_19302]]
−
* [[URACIL-PRIBOSYLTRANS-RXN]]
+
** Source: [[orthology-synechocystis]]
−
* [[PHOSNACMURPENTATRANS-RXN]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Tiso_gene_10876]]
−
* [[RXN-8975]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[URKI-RXN]]
+
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58-97-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : ump
+
{{#set: common name=polyketide_synthase}}
−
* PUBCHEM:
+
{{#set: common name=3-oxoacyl-synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1778309 1778309]
+
{{#set: ec number=EC-2.3.1.86}}
−
* HMDB : HMDB00288
+
{{#set: ec number=EC-2.3.1.85}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1.41}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00105 C00105]
+
{{#set: common name=β-ketoacyl-ACP synthase I|β-ketoacyl-acyl carrier protein synthetase|β-ketoacyl-[acyl carrier protein] synthase|condensing enzyme|β-ketoacyl acyl carrier protein synthase|3-oxoacyl-[acyl-carrier-protein] synthase|acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_500|Tiso_gene_13394|Tiso_gene_15991|Tiso_gene_14485|Tiso_gene_135|Tiso_gene_19302|Tiso_gene_10876|Tiso_gene_5939|Tiso_gene_136}}
−
** [http://www.chemspider.com/Chemical-Structure.1399139.html 1399139]
+
{{#set: in pathway=PWY-5971}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57865 57865]
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
−
* METABOLIGHTS : MTBLC57865
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: common name=UMP}}
+
−
{{#set: inchi key=InChIKey=DJJCXFVJDGTHFX-XVFCMESISA-L}}
+
−
{{#set: molecular weight=322.168    }}
+
−
{{#set: common name=uridylate|5'-UMP|uridine 5'-phosphate|5'-uridylic acid (8CI)(9CI)|uridine monophosphate|uridine 5'-monophosphate}}
+
−
{{#set: consumed by=UMPKf|RXN-14025|UMPP|RXN-12002}}
+
−
{{#set: produced by=orPDC|UTPPH|GTUP|AUPT|OROTPDECARB-RXN|UTUP|DGTUP|RXN-11347|DUTUP|DCTUP|2.7.8.15-RXN|DATUP|RXN-14139|RXN-12197|UPH|DTTUP|RXN-12199|URIDINEKIN-RXN|ITUP|URACIL-PRIBOSYLTRANS-RXN|PHOSNACMURPENTATRANS-RXN}}
+
−
{{#set: reversible reaction associated=RXN-8975|URKI-RXN}}
+

Latest revision as of 19:32, 21 March 2018

Reaction RXN-9535

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):
    • β-ketoacyl-ACP synthase I
    • β-ketoacyl-acyl carrier protein synthetase
    • β-ketoacyl-[acyl carrier protein] synthase
    • condensing enzyme
    • β-ketoacyl acyl carrier protein synthase
    • 3-oxoacyl-[acyl-carrier-protein] synthase
    • acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

  • "β-ketoacyl-[acyl carrier protein] synthase" cannot be used as a page name in this wiki.
  • "3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.
  • "acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] C-acyltransferase (decarboxylating)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9535&oldid=42281"