Difference between revisions of "PWY-6098"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * common name: ** tropinone * inc...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-13819 TAX-1...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098] ==
* smiles:
+
* taxonomic range:
** C[N+]1(C2(CCC1CC(=O)C2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-13819 TAX-13819]
 
* common name:
 
* common name:
** tropinone
+
** diploterol and cycloartenol biosynthesis
* inchi key:
+
** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
+
* molecular weight:
+
** 140.205   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 22-hydroxyphopane-1 biosynthesis
 +
** cycloartenol biosynthesis
 +
** diploterol biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[5.4.99.17-RXN]]
* [[TROPINE-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_12198]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14526]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-4961 RXN-4961]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE-MONOOXYGENASE-RXN SQUALENE-MONOOXYGENASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-13819}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003]
+
{{#set: common name=diploterol and cycloartenol biosynthesis}}
* CAS : 532-24-1
+
{{#set: common name=22-hydroxyphopane-1 biosynthesis|cycloartenol biosynthesis|diploterol biosynthesis}}
* NCI:
+
{{#set: reaction found=2}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012]
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851]
+
{{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}}
+
{{#set: common name=tropinone}}
+
{{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}}
+
{{#set: molecular weight=140.205    }}
+
{{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-6098

  • taxonomic range:
  • common name:
    • diploterol and cycloartenol biosynthesis
  • Synonym(s):
    • 22-hydroxyphopane-1 biosynthesis
    • cycloartenol biosynthesis
    • diploterol biosynthesis

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links