Difference between revisions of "PWY-7179"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * commo...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7179 PWY-7179] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7179 PWY-7179] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
− | ** | + | ** purine deoxyribonucleosides degradation I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
− | * | + | * [[ADDALT-RXN]] |
− | + | ** 2 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_19373]] |
− | * [[ | + | *** [[Tiso_gene_18322]] |
− | * | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | == Reaction(s) | + | == Reaction(s) not found == |
− | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENPHOSPHOR-RXN DEOXYADENPHOSPHOR-RXN] |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANPHOSPHOR-RXN DEOXYGUANPHOSPHOR-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOPHOSPHOR-RXN DEOXYINOPHOSPHOR-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7179 PWY-7179] | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=purine deoxyribonucleosides degradation I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Pathway PWY-7179
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- ADDALT-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: