Difference between revisions of "Tiso gene 1684"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * smiles: ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O *...") |
(Created page with "Category:Gene == Gene Tiso_gene_1684 == * right end position: ** 15239 * transcription direction: ** POSITIVE * left end position: ** 14651 * centisome position: ** 46.896...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1684 == |
− | * | + | * right end position: |
− | ** | + | ** 15239 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 14651 |
− | * | + | * centisome position: |
− | ** | + | ** 46.896706 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN0-2161]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[SERINE--TRNA-LIGASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
+ | * [[PWY0-901]] | ||
+ | * [[PWY-6281]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=15239}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=14651}} | |
− | + | {{#set: centisome position=46.896706 }} | |
− | + | {{#set: reaction associated=RXN0-2161|SERINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY|PWY0-901|PWY-6281}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:35, 21 March 2018
Gene Tiso_gene_1684
- right end position:
- 15239
- transcription direction:
- POSITIVE
- left end position:
- 14651
- centisome position:
- 46.896706
- Synonym(s):
Reactions associated
- Reaction: RXN0-2161
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: SERINE--TRNA-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation