Difference between revisions of "CPD-4126"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_910 == * right end position: ** 16111 * transcription direction: ** POSITIVE * left end position: ** 15174 * centisome position: ** 54.8114...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 5-dehydroavenasterol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 410.682 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-4210]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-4209]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263331 44263331] |
| − | {{#set: | + | * HMDB : HMDB06852 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783] | ||
| + | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=5-dehydroavenasterol}} | ||
| + | {{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}} | ||
| + | {{#set: molecular weight=410.682 }} | ||
| + | {{#set: consumed by=RXN-4210}} | ||
| + | {{#set: produced by=RXN-4209}} | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite CPD-4126
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 5-dehydroavenasterol
- inchi key:
- InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
- molecular weight:
- 410.682
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
