Difference between revisions of "DIMETHYLGLYCINE-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLGLYCINE-DEHYDROGENASE-RXN DIMETHYLGLYCINE-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLGLYCINE-DEHYDROGENASE-RXN DIMETHYLGLYCINE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** dimethylglycine_dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.5.8.4 EC-1.5.8.4] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SARCOSINE]][c] '''+''' 1 [[ETF-Reduced]][c] '''+''' 1 [[FORMALDEHYDE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 dimethylglycine[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H2O[c] '''=>''' 1 sarcosine[c] '''+''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 formaldehyde[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2717]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661] | ||
+ | ** '''4''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22496 22496] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01565 R01565] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q63342 Q63342] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: common name=dimethylglycine_dehydrogenase}} |
− | ** [http://www. | + | {{#set: ec number=EC-1.5.8.4}} |
− | + | {{#set: gene associated=Tiso_gene_2717}} | |
− | + | {{#set: in pathway=PWY-3661}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction DIMETHYLGLYCINE-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- dimethylglycine_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DIMETHYL-GLYCINE[c] + 1 PROTON[c] + 1 ETF-Oxidized[c] + 1 WATER[c] => 1 SARCOSINE[c] + 1 ETF-Reduced[c] + 1 FORMALDEHYDE[c]
- With common name(s):
- 1 dimethylglycine[c] + 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] + 1 H2O[c] => 1 sarcosine[c] + 1 a reduced electron-transfer flavoprotein[c] + 1 formaldehyde[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2717
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-3661, glycine betaine degradation I: PWY-3661
- 4 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links