Difference between revisions of "RXN1G-526"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * common name: ** 2-phospho-D-glyce...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-tetracos-2-enoyl-[acy...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(OP(=O)([O-])[O-])CO
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 2-phospho-D-glycerate
+
** trans-tetracos-2-enoyl-[acyl-carrier protein] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* molecular weight:
+
−
** 183.034   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-phospho-(D)-glycerate
 
−
** 2-phospho-(R)-glycerate
 
−
** 2-phospho-D-glyceric acid
 
−
** 2-P-D-glycerate
 
−
** D-Glycerate 2-phosphate
 
−
** D-2-phosphoglycerate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[trans-delta2-lignoceroyl-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Lignoceroyl-ACPs]][c]
−
* [[3PGAREARR-RXN]]
+
* With common name(s):
−
* [[2PGADEHYDRAT-RXN]]
+
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-tetracos-2-enoyl-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a lignoceroyl-[acp][c]
−
* [[RXN-15513]]
+
 
−
* [[RXN-15510]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2553-59-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 2pg
+
{{#set: common name=trans-tetracos-2-enoyl-[acyl-carrier protein] reductase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* HMDB : HMDB03391
+
{{#set: in pathway=PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289]
+
−
* METABOLIGHTS : MTBLC58289
+
−
{{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}}
+
−
{{#set: common name=2-phospho-D-glycerate}}
+
−
{{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}}
+
−
{{#set: molecular weight=183.034    }}
+
−
{{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}}
+
−
{{#set: reversible reaction associated=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}}
+

Latest revision as of 19:38, 21 March 2018

Reaction RXN1G-526

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-tetracos-2-enoyl-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-tetracos-2-enoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-526&oldid=42946"