Difference between revisions of "CPD-15526"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7622 PWY-7622] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6231 TAX-62...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * common name:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cyclobutadipyrimidine |
| + | * inchi key: | ||
| + | ** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 238.246 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[3.2.2.17-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923] | |
| − | {{#set: | + | {{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}} |
| − | {{#set: common name= | + | {{#set: common name=cyclobutadipyrimidine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=238.246 }} |
| − | {{#set: | + | {{#set: produced by=3.2.2.17-RXN}} |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-15526
- smiles:
- CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
- common name:
- cyclobutadipyrimidine
- inchi key:
- InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
- molecular weight:
- 238.246
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
