Difference between revisions of "THREONINE-DEG2-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * common n...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* common name: | * common name: | ||
− | ** | + | ** L-threonine degradation II |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** threonine dehydrogenase pathway |
+ | ** TDG pathway | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[AKBLIG-RXN]] | |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_3555]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[THREODEHYD-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_1301]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY] | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-33208}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=L-threonine degradation II}} | |
− | + | {{#set: common name=threonine dehydrogenase pathway|TDG pathway}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:42, 21 March 2018
Pathway THREONINE-DEG2-PWY
- taxonomic range:
- common name:
- L-threonine degradation II
- Synonym(s):
- threonine dehydrogenase pathway
- TDG pathway
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- AKBLIG-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- THREODEHYD-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: