Difference between revisions of "CPD-15436"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATGD ATGD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:GDP phosphotransferase * Synonym(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATGD ATGD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 
* common name:
 
* common name:
−
** ATP:GDP phosphotransferase
+
** (5Z)-tetradecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
 +
* molecular weight:
 +
** 971.845   
 
* Synonym(s):
 
* Synonym(s):
 +
** cis-tetradec-5-enoyl-CoA
 +
** 14:1 cis-5
 +
** 14:1(n-9)
 +
** (5Z)-tetradec-5-enoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14576]]
−
** 1.0 [[ATP]][c] '''+''' 1.0 [[GDP]][c] '''=>''' 1.0 [[GTP]][c] '''+''' 1.0 [[ADP]][c]
+
* [[RXN-17783]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1.0 ATP[c] '''+''' 1.0 GDP[c] '''=>''' 1.0 GTP[c] '''+''' 1.0 ADP[c]
+
* [[RXN-17782]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13128]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_16529]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:GDP phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
−
{{#set: gene associated=Tiso_gene_13128|Tiso_gene_16529}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
 +
{{#set: molecular weight=971.845    }}
 +
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
 +
{{#set: consumed by=RXN-14576|RXN-17783}}
 +
{{#set: produced by=RXN-17782}}

Latest revision as of 19:43, 21 March 2018

Metabolite CPD-15436

  • smiles:
    • CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • common name:
    • (5Z)-tetradecenoyl-CoA
  • inchi key:
    • InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
  • molecular weight:
    • 971.845
  • Synonym(s):
    • cis-tetradec-5-enoyl-CoA
    • 14:1 cis-5
    • 14:1(n-9)
    • (5Z)-tetradec-5-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15436&oldid=43447"