Difference between revisions of "CPD-18118"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-28...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** D-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-arabinofuranose 5-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L | ||
| + | * molecular weight: | ||
| + | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** D-arabinofuranose 5P | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[KDO-8PSYNTH-RXN]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971] |
| − | {{#set: | + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} |
| − | {{#set: | + | {{#set: common name=D-arabinofuranose 5-phosphate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=228.095 }} |
| + | {{#set: common name=D-arabinofuranose 5P}} | ||
| + | {{#set: consumed by=KDO-8PSYNTH-RXN}} | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CPD-18118
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- common name:
- D-arabinofuranose 5-phosphate
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
- molecular weight:
- 228.095
- Synonym(s):
- D-arabinofuranose 5P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.
