Difference between revisions of "PWY-6089"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6089 PWY-6089] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6089 PWY-6089] ==
* smiles:
+
* taxonomic range:
** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** dUTP
+
** 3-chlorocatechol degradation I (ortho)
* inchi key:
+
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
+
* molecular weight:
+
** 464.112   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxy-UTP
 
** 2'-deoxyuridine-5'-triphosphate
 
** deoxyuridine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14199]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[DUTUP]]
+
* [[RXN-9868]]
* [[DUTCP]]
+
** 1 associated gene(s):
* [[DUTNH]]
+
*** [[Tiso_gene_12835]]
* [[RXN-14219]]
+
** 1 reconstruction source(s) associated:
* [[DUTP-PYROP-RXN]]
+
*** [[annotation-in-silico_annotation]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
* [[ATDUDm]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=MALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
* [[ATDUD]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9860 RXN-9860]
* [[DUDPKIN-RXN]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9867 RXN-9867]
== Reaction(s) of unknown directionality ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9894 RXN-9894]
 
== External links  ==
 
== External links  ==
* CAS : 1173-82-6
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=3-chlorocatechol degradation I (ortho)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408]
+
{{#set: reaction found=1}}
* HMDB : HMDB01191
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=20.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555]
+
* BIGG : dutp
+
{{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: common name=dUTP}}
+
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}}
+
{{#set: molecular weight=464.112    }}
+
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}}
+
{{#set: consumed by=RXN-14199|DUTUP|DUTCP|DUTNH|RXN-14219|DUTP-PYROP-RXN}}
+
{{#set: produced by=ATDUDm|ATDUD|DUDPKIN-RXN}}
+

Latest revision as of 19:44, 21 March 2018

Pathway PWY-6089

  • taxonomic range:
  • common name:
    • 3-chlorocatechol degradation I (ortho)
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links