Difference between revisions of "ACACT7"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * common name...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT7 ACACT7] == * direction: ** REVERSIBLE * common name: ** myristoyl-CoA:acetylCoA C-myristoylt...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT7 ACACT7] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
| − | ** | + | ** myristoyl-CoA:acetylCoA C-myristoyltransferase |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[CO-A]][x] '''+''' 1.0 [[3-OXOPALMITOYL-COA]][x] '''<=>''' 1.0 [[TETRADECANOYL-COA]][x] '''+''' 1.0 [[ACETYL-COA]][x] |
| − | == | + | * With common name(s): |
| + | ** 1.0 coenzyme A[x] '''+''' 1.0 3-oxo-palmitoyl-CoA[x] '''<=>''' 1.0 myristoyl-CoA[x] '''+''' 1.0 acetyl-CoA[x] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_16181]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=myristoyl-CoA:acetylCoA C-myristoyltransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_16181}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:44, 21 March 2018
Contents
Reaction ACACT7
- direction:
- REVERSIBLE
- common name:
- myristoyl-CoA:acetylCoA C-myristoyltransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 CO-A[x] + 1.0 3-OXOPALMITOYL-COA[x] <=> 1.0 TETRADECANOYL-COA[x] + 1.0 ACETYL-COA[x]
- With common name(s):
- 1.0 coenzyme A[x] + 1.0 3-oxo-palmitoyl-CoA[x] <=> 1.0 myristoyl-CoA[x] + 1.0 acetyl-CoA[x]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16181
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
