Difference between revisions of "CPD-1789"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * smiles: ** CC1(N=CC(COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * common name: ** dehydro-D-arabino...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(C(O)=C(O)C(=O)O1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dehydro-D-arabinono-1,4-lactone |
+ | * inchi key: | ||
+ | ** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 146.099 |
* Synonym(s): | * Synonym(s): | ||
− | ** 4- | + | ** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one |
− | ** | + | ** D-erythro-ascorbic acid |
− | ** | + | ** D-erythro-ascorbate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.1.3.37-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316] |
− | {{#set: smiles= | + | {{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}} |
− | {{#set: | + | {{#set: common name=dehydro-D-arabinono-1,4-lactone}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=146.099 }} |
− | {{#set: common name=4- | + | {{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}} |
− | {{#set: | + | {{#set: produced by=1.1.3.37-RXN}} |
Latest revision as of 20:36, 21 March 2018
Contents
Metabolite CPD-1789
- smiles:
- C(O)C1(C(O)=C(O)C(=O)O1)
- common name:
- dehydro-D-arabinono-1,4-lactone
- inchi key:
- InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
- molecular weight:
- 146.099
- Synonym(s):
- (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
- D-erythro-ascorbic acid
- D-erythro-ascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links