Difference between revisions of "RXN1K-87"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * common name: ** L-aspar...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1K-87 RXN1K-87] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1K-87 RXN1K-87] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-787]][c] '''=>''' 1 [[CPD-786]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate[c] '''=>''' 1 (4Z)-2-oxohept-4-enedioate[c] | |
| − | + | ||
| − | * | + | == Genes associated with this reaction == |
| − | * | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * | + | * Gene: [[Tiso_gene_19690]] |
| − | + | ** Source: [[orthology-athaliana]] | |
| − | + | == Pathways == | |
| − | + | == Reconstruction information == | |
| − | == | + | * Category: [[orthology]] |
| − | * [[ | + | ** Source: [[orthology-athaliana]] |
| − | * [[ | + | *** Tool: [[pantograph]] |
| − | == | + | |
| − | + | ||
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04134 R04134] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: gene associated=Tiso_gene_19690}} | |
| − | + | {{#set: in pathway=}} | |
| − | * LIGAND- | + | {{#set: reconstruction category=orthology}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=orthology-athaliana}} |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:46, 21 March 2018
Contents
Reaction RXN1K-87
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate[c] => 1 (4Z)-2-oxohept-4-enedioate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19690
- Source: orthology-athaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links
- LIGAND-RXN:
