|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGLUCISOM-RXN PGLUCISOM-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-P-PANTOTHENATE 4-P-PANTOTHENATE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)C |
| * common name: | | * common name: |
− | ** glucose-6-phosphate_isomerase | + | ** (R)-4'-phosphopantothenate |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/5.3.1.9 EC-5.3.1.9] | + | ** InChIKey=XHFVGHPGDLDEQO-ZETCQYMHSA-K |
| + | * molecular weight: |
| + | ** 296.193 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 4'-phosphopantothenate |
| + | ** 4'-P-Pantothenate |
| + | ** D-4'-phosphopantothenate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[P-PANTOCYSLIG-RXN]] |
− | ** 1 [[D-glucopyranose-6-phosphate]][c] '''<=>''' 1 [[FRUCTOSE-6P]][c]
| + | * [[RXN66-555]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 D-glucopyranose 6-phosphate[c] '''<=>''' 1 β-D-fructofuranose 6-phosphate[c]
| + | * [[PANTOTHENATE-KIN-RXN]] |
− | | + | == Reaction(s) of unknown directionality == |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Tiso_gene_19480]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | == Pathways ==
| + | |
− | * [[RUMP-PWY]], formaldehyde oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY]
| + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
| + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7385]], 1,3-propanediol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] | + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''11''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142] | + | |
− | ** '''8''' reactions found over '''14''' reactions in the full pathway
| + | |
− | * [[PWY-5659]], GDP-mannose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6981]], chitin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6981 PWY-6981]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[P341-PWY]], glycolysis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[PWY-7347]], sucrose biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7347 PWY-7347]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399] | + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[SUCSYN-PWY]], sucrose biosynthesis I (from photosynthesis): [http://metacyc.org/META/NEW-IMAGE?object=SUCSYN-PWY SUCSYN-PWY]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[UDPNAGSYN-PWY]], UDP-N-acetyl-D-glucosamine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=UDPNAGSYN-PWY UDPNAGSYN-PWY]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-622]], starch biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-622 PWY-622]
| + | |
− | ** '''2''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5054]], sorbitol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5054 PWY-5054]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-6992]], 1,5-anhydrofructose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5514]], UDP-N-acetyl-D-galactosamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| + | |
− | ** '''14''' reactions found over '''18''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * BIGG : 4ppan |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11816 11816] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755653 16755653] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00771 R00771] | + | * HMDB : HMDB01016 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P06744 P06744] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03492 C03492] |
− | ** [http://www.uniprot.org/uniprot/P28718 P28718]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q7LZP0 Q7LZP0]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10986 10986] |
− | ** [http://www.uniprot.org/uniprot/O83488 O83488] | + | * METABOLIGHTS : MTBLC10986 |
− | ** [http://www.uniprot.org/uniprot/Q9JTW1 Q9JTW1]
| + | {{#set: smiles=CC(C(C(=O)NCCC(=O)[O-])O)(COP([O-])([O-])=O)C}} |
− | ** [http://www.uniprot.org/uniprot/Q59000 Q59000]
| + | {{#set: common name=(R)-4'-phosphopantothenate}} |
− | ** [http://www.uniprot.org/uniprot/Q9PMD4 Q9PMD4]
| + | {{#set: inchi key=InChIKey=XHFVGHPGDLDEQO-ZETCQYMHSA-K}} |
− | ** [http://www.uniprot.org/uniprot/O25781 O25781]
| + | {{#set: molecular weight=296.193 }} |
− | ** [http://www.uniprot.org/uniprot/O84382 O84382]
| + | {{#set: common name=4'-phosphopantothenate|4'-P-Pantothenate|D-4'-phosphopantothenate}} |
− | ** [http://www.uniprot.org/uniprot/Q9JSS6 Q9JSS6]
| + | {{#set: consumed by=P-PANTOCYSLIG-RXN|RXN66-555}} |
− | ** [http://www.uniprot.org/uniprot/P81181 P81181]
| + | {{#set: produced by=PANTOTHENATE-KIN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P08059 P08059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50309 P50309]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13376 P13376]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13375 P13375]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12709 P12709]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A6T1 P0A6T1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06745 P06745]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13377 P13377]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12341 P12341]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18240 P18240]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29333 P29333]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34796 P34796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34797 P34797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54240 P54240]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54242 P54242]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59088 Q59088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78033 P78033]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52983 P52983]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49105 P49105]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42862 P42862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42863 P42863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SB57 Q9SB57]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82058 O82058]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82059 O82059]
| + | |
− | ** [http://www.uniprot.org/uniprot/O61113 O61113]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78917 P78917]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RMC1 Q9RMC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X670 Q9X670]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=glucose-6-phosphate_isomerase}} | + | |
− | {{#set: ec number=EC-5.3.1.9}} | + | |
− | {{#set: gene associated=Tiso_gene_19480}} | + | |
− | {{#set: in pathway=RUMP-PWY|GLYCOLYSIS|PWY-3801|PWY-7385|P124-PWY|PWY-6142|PWY-5659|PWY-6981|P341-PWY|GLUCONEO-PWY|PWY-7347|PWY66-399|SUCSYN-PWY|UDPNAGSYN-PWY|PWY-621|PWY-622|PWY-5054|PWY-6992|ANAGLYCOLYSIS-PWY|PWY-5384|PWY-7238|PWY-5514|P122-PWY}} | + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |