Difference between revisions of "CPD-13171"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-332...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
 
* common name:
 
* common name:
** cholesterol biosynthesis III (via desmosterol)
+
** 15,9'-di-cis-phytofluene
 +
* molecular weight:
 +
** 542.93   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''7''' reactions found over '''22''' reactions in the full pathway
+
* [[RXN-12244]]
* [[RXN66-27]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
* [[RXN-12243]]
*** [[Tiso_gene_8982]]
+
== Reaction(s) of unknown directionality ==
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-303]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_8263]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-304]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_8263]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-305]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_8263]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-306]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_10982]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-313]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_897]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN66-318]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_897]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-28 RXN66-28]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-320 RXN66-320]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33208}}
+
* LIGAND-CPD:
{{#set: common name=cholesterol biosynthesis III (via desmosterol)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19765 C19765]
{{#set: reaction found=7}}
+
* CHEBI:
{{#set: total reaction=22}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61990 61990]
{{#set: completion rate=32.0}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351778 51351778]
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N}}
 +
{{#set: common name=15,9'-di-cis-phytofluene}}
 +
{{#set: molecular weight=542.93    }}
 +
{{#set: consumed by=RXN-12244}}
 +
{{#set: produced by=RXN-12243}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-13171

  • smiles:
    • CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
  • common name:
    • 15,9'-di-cis-phytofluene
  • molecular weight:
    • 542.93
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links