Difference between revisions of "CPD-289"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17310 == * right end position: ** 3727 * transcription direction: ** POSITIVE * left end position: ** 1715 * centisome position: ** 45.2029...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == * smiles: ** C1(=CC(C(C=C1)O)O) * common name: ** (1R,2R)-cyclohexa-3,5-die...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=CC(C(C=C1)O)O) |
| − | * | + | * common name: |
| − | ** | + | ** (1R,2R)-cyclohexa-3,5-diene-1,2-diol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 112.128 |
* Synonym(s): | * Synonym(s): | ||
| + | ** trans-1,2-dihydrobenzene-1,2-diol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[1.3.1.20-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=149186 149186] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.131491.html 131491] |
| − | {{#set: | + | * HMDB : HMDB01164 |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10702 10702] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04221 C04221] | ||
| + | {{#set: smiles=C1(=CC(C(C=C1)O)O)}} | ||
| + | {{#set: common name=(1R,2R)-cyclohexa-3,5-diene-1,2-diol}} | ||
| + | {{#set: inchi key=InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N}} | ||
| + | {{#set: molecular weight=112.128 }} | ||
| + | {{#set: common name=trans-1,2-dihydrobenzene-1,2-diol}} | ||
| + | {{#set: reversible reaction associated=1.3.1.20-RXN}} | ||
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-289
- smiles:
- C1(=CC(C(C=C1)O)O)
- common name:
- (1R,2R)-cyclohexa-3,5-diene-1,2-diol
- inchi key:
- InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N
- molecular weight:
- 112.128
- Synonym(s):
- trans-1,2-dihydrobenzene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
