Difference between revisions of "SHIKIMATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8328 == * right end position: ** 2849 * transcription direction: ** POSITIVE * left end position: ** 585 * centisome position: ** 5.6581874...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * common name: ** shikimat...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) |
| − | * | + | * common name: |
| − | ** | + | ** shikimate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 173.145 |
* Synonym(s): | * Synonym(s): | ||
| + | ** shikimic acid | ||
| + | ** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7968]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| + | * [[SHIKIMATE-KINASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 138-59-0 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976] |
| − | {{#set: | + | * HMDB : HMDB03070 |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208] | ||
| + | * BIGG : skm | ||
| + | {{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}} | ||
| + | {{#set: common name=shikimate}} | ||
| + | {{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}} | ||
| + | {{#set: molecular weight=173.145 }} | ||
| + | {{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}} | ||
| + | {{#set: consumed by=RXN-7968}} | ||
| + | {{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}} | ||
| + | {{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite SHIKIMATE
- smiles:
- C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
- common name:
- shikimate
- inchi key:
- InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
- molecular weight:
- 173.145
- Synonym(s):
- shikimic acid
- (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 138-59-0
- PUBCHEM:
- HMDB : HMDB03070
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : skm
"C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])" cannot be used as a page name in this wiki.
