Difference between revisions of "RXN-16076"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * common name: ** Nα-acetyl-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16076 RXN-16076] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16076 RXN-16076] ==
* smiles:
+
* direction:
** CC(=O)NC(CCSC)C([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** Nα-acetyl-L-methionine
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
* inchi key:
+
* ec number:
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
* molecular weight:
+
** 190.237   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-L-methionine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN0-6948]]
+
** 1 [[CPD0-2113]][c] '''+''' 1 [[Stearoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CPD0-1423]][c]
* [[RXN-17893]]
+
* With common name(s):
* [[RXN-17892]]
+
** 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''+''' 1 a stearoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01646
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: ec number=EC-2.3.1.51}}
* HMDB : HMDB11745
+
{{#set: gene associated=Tiso_gene_13959}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: reconstruction category=annotation}}
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
{{#set: common name=Nα-acetyl-L-methionine}}
+
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
{{#set: molecular weight=190.237    }}
+
{{#set: common name=N-acetyl-L-methionine}}
+
{{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}}
+

Latest revision as of 19:49, 21 March 2018

Reaction RXN-16076

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 1-stearoyl-sn-glycerol 3-phosphate[c] + 1 a stearoyl-[acp][c] => 1 a holo-[acyl-carrier protein][c] + 1 1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links