Difference between revisions of "RXN-8899"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * common name: ** cyclic...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8899 RXN-8899] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8899 RXN-8899] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[PROTON]][c] '''+''' 1 [[2-AMINOACRYLATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[AMMONIUM]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H+[c] '''+''' 1 2-aminoprop-2-enoate[c] '''+''' 1 H2O[c] '''=>''' 1 pyruvate[c] '''+''' 1 ammonium[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7614]], methiin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7614 PWY-7614] | ||
+ | ** '''1''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-5707]], propanethial S-oxide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5707 PWY-5707] | ||
+ | ** '''1''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-5706]], alliin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5706 PWY-5706] | ||
+ | ** '''1''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-5708]], ethiin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5708 PWY-5708] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6539]], (Z)-phenylmethanethial S-oxide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6539 PWY-6539] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08698 R08698] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: in pathway=PWY-7614|PWY-5707|PWY-5706|PWY-5708|PWY-6539}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction RXN-8899
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 2-AMINOACRYLATE[c] + 1 WATER[c] => 1 PYRUVATE[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 H+[c] + 1 2-aminoprop-2-enoate[c] + 1 H2O[c] => 1 pyruvate[c] + 1 ammonium[c]
Genes associated with this reaction
Pathways
- PWY-7614, methiin metabolism: PWY-7614
- 1 reactions found over 7 reactions in the full pathway
- PWY-5707, propanethial S-oxide biosynthesis: PWY-5707
- 1 reactions found over 9 reactions in the full pathway
- PWY-5706, alliin metabolism: PWY-5706
- 1 reactions found over 11 reactions in the full pathway
- PWY-5708, ethiin metabolism: PWY-5708
- 1 reactions found over 5 reactions in the full pathway
- PWY-6539, (Z)-phenylmethanethial S-oxide biosynthesis: PWY-6539
- 1 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: