Difference between revisions of "NQOR-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * common name: ** guanine * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NQOR-RXN NQOR-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** possible_vitamin_k_epoxide_pl...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NQOR-RXN NQOR-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** possible_vitamin_k_epoxide_plastid_protein |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.6.5.2 EC-1.6.5.2] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[ETR-Quinones]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 an electron-transfer quinone[c] '''+''' 1 H+[c] '''+''' 1 NAD(P)H[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 NAD(P)+[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| + | * Gene: [[Tiso_gene_10318]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * UNIPROT: |
| − | * | + | ** [http://www.uniprot.org/uniprot/P15559 P15559] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P16083 P16083] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P05982 P05982] |
| − | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q64669 Q64669] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P0A756 P0A756] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P43340 P43340] |
| − | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0A754 P0A754] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P45245 P45245] |
| − | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=possible_vitamin_k_epoxide_plastid_protein}} | |
| − | ** [http://www. | + | {{#set: ec number=EC-1.6.5.2}} |
| − | + | {{#set: gene associated=Tiso_gene_10318}} | |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: common name= | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction NQOR-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- possible_vitamin_k_epoxide_plastid_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETR-Quinones[c] + 1 PROTON[c] + 1 NADH-P-OR-NOP[c] => 1 ETR-Quinols[c] + 1 NAD-P-OR-NOP[c]
- With common name(s):
- 1 an electron-transfer quinone[c] + 1 H+[c] + 1 NAD(P)H[c] => 1 an electron-transfer quinol[c] + 1 NAD(P)+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10318
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
