Difference between revisions of "GCVP-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-ga...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCVP-RXN GCVP-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.4.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCVP-RXN GCVP-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.4.4.2 EC-1.4.4.2] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[PROTEIN-LIPOYLLYSINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLY]][c] '''<=>''' 1 [[AMINOMETHYLDIHYDROLIPOYL-GCVH]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 a [glycine-cleavage complex H protein] N6-lipoyl-L-lysine[c] '''+''' 1 H+[c] '''+''' 1 glycine[c] '''<=>''' 1 a [glycine-cleavage complex H protein] N6-aminomethyldihydrolipoyl-L-lysine[c] '''+''' 1 CO2[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17287]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_428]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[GLYCINE-SYN2-PWY]], glycine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-SYN2-PWY GLYCINE-SYN2-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[GLYCLEAV-PWY]], glycine cleavage: [http://metacyc.org/META/NEW-IMAGE?object=GLYCLEAV-PWY GLYCLEAV-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03425 R03425] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P26969 P26969] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9UXT1 Q9UXT1] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9JT86 Q9JT86] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9UXT0 Q9UXT0] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P23378 P23378] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P33195 P33195] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O80988 O80988] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q94B78 Q94B78] |
+ | ** [http://www.uniprot.org/uniprot/O32915 O32915] | ||
+ | ** [http://www.uniprot.org/uniprot/O22575 O22575] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-1.4.4.2}} | ||
+ | {{#set: gene associated=Tiso_gene_17287|Tiso_gene_428}} | ||
+ | {{#set: in pathway=GLYCINE-SYN2-PWY|GLYCLEAV-PWY}} | ||
+ | {{#set: reconstruction category=orthology|manual}} | ||
+ | {{#set: reconstruction source=manual-primary_network|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:51, 21 March 2018
Contents
Reaction GCVP-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTEIN-LIPOYLLYSINE[c] + 1 PROTON[c] + 1 GLY[c] <=> 1 AMINOMETHYLDIHYDROLIPOYL-GCVH[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 a [glycine-cleavage complex H protein] N6-lipoyl-L-lysine[c] + 1 H+[c] + 1 glycine[c] <=> 1 a [glycine-cleavage complex H protein] N6-aminomethyldihydrolipoyl-L-lysine[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17287
- Source: orthology-esiliculosus
- Gene: Tiso_gene_428
- Source: orthology-esiliculosus
Pathways
- GLYCINE-SYN2-PWY, glycine biosynthesis II: GLYCINE-SYN2-PWY
- 2 reactions found over 3 reactions in the full pathway
- GLYCLEAV-PWY, glycine cleavage: GLYCLEAV-PWY
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
External links