|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRIOSEPISOMERIZATION-RXN TRIOSEPISOMERIZATION-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(OCC([N+])C(=O)[O-])=O |
| * common name: | | * common name: |
− | ** ORF | + | ** O-acetyl-L-serine |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/5.3.1.1 EC-5.3.1.1] | + | ** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N |
| + | * molecular weight: |
| + | ** 147.13 |
| * Synonym(s): | | * Synonym(s): |
| + | ** O3-acetyl-L-serine |
| + | ** acetylserine |
| + | ** O-acetylserine |
| + | ** (2S)-3-acetyloxy-2-aminopropanoate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-12726]] |
− | ** 1 [[GAP]][c] '''<=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[SERINE-O-ACETTRAN-RXN]] |
− | ** 1 D-glyceraldehyde 3-phosphate[c] '''<=>''' 1 glycerone phosphate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | * [[ACSERLY-RXN]] |
− | == Genes associated with this reaction ==
| + | * [[SULFOCYS-RXN]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Tiso_gene_19961]] | + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Gene: [[Tiso_gene_20000]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_19962]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_10646]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P341-PWY]], glycolysis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY] | + | |
− | ** '''11''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
| + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
| + | |
− | ** '''8''' reactions found over '''14''' reactions in the full pathway
| + | |
− | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
| + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY66-373]], sucrose degradation V (sucrose α-glucosidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373] | + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003] | + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-athaliana]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-synechocystis]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 66638-22-0 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18585 18585]
| + | * BIGG : acser |
− | * LIGAND-RXN:
| + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01015 R01015]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051] |
− | * UNIPROT: | + | * HMDB : HMDB03011 |
− | ** [http://www.uniprot.org/uniprot/P19118 P19118] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P21820 P21820] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979] |
− | ** [http://www.uniprot.org/uniprot/P48501 P48501]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P62002 P62002]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340] |
− | ** [http://www.uniprot.org/uniprot/O27120 O27120] | + | * METABOLIGHTS : MTBLC17981 |
− | ** [http://www.uniprot.org/uniprot/P27876 P27876] | + | {{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q9PMQ6 Q9PMQ6] | + | {{#set: common name=O-acetyl-L-serine}} |
− | ** [http://www.uniprot.org/uniprot/P19583 P19583] | + | {{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q9UXX2 Q9UXX2] | + | {{#set: molecular weight=147.13 }} |
− | ** [http://www.uniprot.org/uniprot/P47721 P47721]
| + | {{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}} |
− | ** [http://www.uniprot.org/uniprot/P47670 P47670]
| + | {{#set: consumed by=RXN-12726}} |
− | ** [http://www.uniprot.org/uniprot/P50918 P50918] | + | {{#set: produced by=SERINE-O-ACETTRAN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P43727 P43727]
| + | {{#set: reversible reaction associated=ACSERLY-RXN|SULFOCYS-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q58923 Q58923]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28965 O28965]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59182 Q59182]
| + | |
− | ** [http://www.uniprot.org/uniprot/O59536 O59536]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36204 P36204]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JW31 Q9JW31]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04828 P04828]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00943 P00943]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00942 P00942]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00940 P00940]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60175 P60175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A858 P0A858]
| + | |
− | ** [http://www.uniprot.org/uniprot/P60174 P60174]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00941 P00941]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15426 P15426]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17751 P17751]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00939 P00939]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12863 P12863]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07669 P07669]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35144 P35144]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48494 P48494]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4X7 Q7M4X7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29613 P29613]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30741 P30741]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01893 Q01893]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48499 P48499]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48496 P48496]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46226 P46226]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46225 P46225]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48492 P48492]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56738 Q56738]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZE5 Q7LZE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46711 P46711]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32757 O32757]
| + | |
− | ** [http://www.uniprot.org/uniprot/O74067 O74067]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48491 P48491]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: ec number=EC-5.3.1.1}} | + | |
− | {{#set: gene associated=Tiso_gene_19961|Tiso_gene_20000|Tiso_gene_19962|Tiso_gene_10646}} | + | |
− | {{#set: in pathway=PWY-1042|P341-PWY|PWY66-399|P185-PWY|GLUCONEO-PWY|GLYCOLYSIS|PWY-6142|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|PWY66-373|PWY-7003}} | + | |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |