Difference between revisions of "CPDQT-39"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * smiles: ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-iso...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(6'-me...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == |
* smiles: | * smiles: | ||
− | ** CSCCCCCCC(C( | + | ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] |
* common name: | * common name: | ||
− | ** 3- | + | ** 3-(6'-methylthio)hexylmalate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 262.32 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-(6'-methylthio)hexylmalic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXNQT-4174]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-18202]] | * [[RXN-18202]] | ||
== External links == | == External links == | ||
− | {{#set: smiles=CSCCCCCCC(C( | + | * PUBCHEM: |
− | {{#set: common name=3- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
− | {{#set: molecular weight= | + | {{#set: common name=3-(6'-methylthio)hexylmalate}} |
− | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}} |
+ | {{#set: molecular weight=262.32 }} | ||
+ | {{#set: common name=3-(6'-methylthio)hexylmalic acid}} | ||
+ | {{#set: consumed by=RXNQT-4174}} | ||
{{#set: reversible reaction associated=RXN-18202}} | {{#set: reversible reaction associated=RXN-18202}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPDQT-39
- smiles:
- CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-(6'-methylthio)hexylmalate
- inchi key:
- InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
- molecular weight:
- 262.32
- Synonym(s):
- 3-(6'-methylthio)hexylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.